C21H31N3O2S — CID 54789040
N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]heptanamide (PubChem CID 54789040) has the molecular formula C21H31N3O2S and a molecular weight of 389.57 g/mol. Its IUPAC name is N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]heptanamide.
| Compound Name | N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]heptanamide |
|---|---|
| PubChem CID | 54789040 |
| Molecular Formula | C21H31N3O2S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]heptanamide |
| SMILES | CCCCCCC(=O)NC(=S)Nc1ccccc1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C21H31N3O2S/c1-2-3-4-7-14-19(25)23-21(27)22-18-13-9-8-12-17(18)20(26)24-15-10-5-6-11-16-24/h8-9,12-13H,2-7,10-11,14-16H2,1H3,(H2,22,23,25,27) |
| InChIKey | RXWLFEICCJNXDK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|