C34H46N4O4 — CID 17080136
N,N'-bis[2-(piperidine-1-carbonyl)phenyl]decanediamide (PubChem CID 17080136) has the molecular formula C34H46N4O4 and a molecular weight of 574.77 g/mol. Its IUPAC name is N,N'-bis[2-(piperidine-1-carbonyl)phenyl]decanediamide.
| Compound Name | N,N'-bis[2-(piperidine-1-carbonyl)phenyl]decanediamide |
|---|---|
| PubChem CID | 17080136 |
| Molecular Formula | C34H46N4O4 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | N,N'-bis[2-(piperidine-1-carbonyl)phenyl]decanediamide |
| SMILES | O=C(CCCCCCCCC(=O)Nc1ccccc1C(=O)N1CCCCC1)Nc1ccccc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C34H46N4O4/c39-31(35-29-19-11-9-17-27(29)33(41)37-23-13-5-14-24-37)21-7-3-1-2-4-8-22-32(40)36-30-20-12-10-18-28(30)34(42)38-25-15-6-16-26-38/h9-12,17-20H,1-8,13-16,21-26H2,(H,35,39)(H,36,40) |
| InChIKey | UEYZKWRRPFVDIM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|