C22H26N2O4 — CID 4949518
3-phenylpropyl 4-[2-(ethylcarbamoyl)anilino]-4-oxobutanoate (PubChem CID 4949518) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-phenylpropyl 4-[2-(ethylcarbamoyl)anilino]-4-oxobutanoate.
| Compound Name | 3-phenylpropyl 4-[2-(ethylcarbamoyl)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4949518 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 3-phenylpropyl 4-[2-(ethylcarbamoyl)anilino]-4-oxobutanoate |
| SMILES | CCNC(=O)c1ccccc1NC(=O)CCC(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C22H26N2O4/c1-2-23-22(27)18-12-6-7-13-19(18)24-20(25)14-15-21(26)28-16-8-11-17-9-4-3-5-10-17/h3-7,9-10,12-13H,2,8,11,14-16H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | CDTGBBWATJZJFI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|