C32H44N2O6 — CID 4935320
3-phenylpropyl 4-oxo-4-[6-[[4-oxo-4-(3-phenylpropoxy)butanoyl]amino]hexylamino]butanoate (PubChem CID 4935320) has the molecular formula C32H44N2O6 and a molecular weight of 552.71 g/mol. Its IUPAC name is 3-phenylpropyl 4-oxo-4-[6-[[4-oxo-4-(3-phenylpropoxy)butanoyl]amino]hexylamino]butanoate.
| Compound Name | 3-phenylpropyl 4-oxo-4-[6-[[4-oxo-4-(3-phenylpropoxy)butanoyl]amino]hexylamino]butanoate |
|---|---|
| PubChem CID | 4935320 |
| Molecular Formula | C32H44N2O6 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | 3-phenylpropyl 4-oxo-4-[6-[[4-oxo-4-(3-phenylpropoxy)butanoyl]amino]hexylamino]butanoate |
| SMILES | O=C(CCC(=O)OCCCc1ccccc1)NCCCCCCNC(=O)CCC(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C32H44N2O6/c35-29(19-21-31(37)39-25-11-17-27-13-5-3-6-14-27)33-23-9-1-2-10-24-34-30(36)20-22-32(38)40-26-12-18-28-15-7-4-8-16-28/h3-8,13-16H,1-2,9-12,17-26H2,(H,33,35)(H,34,36) |
| InChIKey | AYYFMPZRSCGBME-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|