C19H27NO3 — CID 4779106
3-phenylpropyl 4-(cyclohexylamino)-4-oxobutanoate (PubChem CID 4779106) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-phenylpropyl 4-(cyclohexylamino)-4-oxobutanoate.
| Compound Name | 3-phenylpropyl 4-(cyclohexylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 4779106 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 3-phenylpropyl 4-(cyclohexylamino)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCCCc1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C19H27NO3/c21-18(20-17-11-5-2-6-12-17)13-14-19(22)23-15-7-10-16-8-3-1-4-9-16/h1,3-4,8-9,17H,2,5-7,10-15H2,(H,20,21) |
| InChIKey | FDHXSSSAJPPWKM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|