C18H23NO4 — CID 134398280
benzyl 5-(cyclohexylamino)-2,5-dioxopentanoate (PubChem CID 134398280) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is benzyl 5-(cyclohexylamino)-2,5-dioxopentanoate.
| Compound Name | benzyl 5-(cyclohexylamino)-2,5-dioxopentanoate |
|---|---|
| PubChem CID | 134398280 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | benzyl 5-(cyclohexylamino)-2,5-dioxopentanoate |
| SMILES | O=C(CCC(=O)C(=O)OCc1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C18H23NO4/c20-16(18(22)23-13-14-7-3-1-4-8-14)11-12-17(21)19-15-9-5-2-6-10-15/h1,3-4,7-8,15H,2,5-6,9-13H2,(H,19,21) |
| InChIKey | WYQLWEJWBOKXQH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|