C17H24N2O3 — CID 18108659
benzyl N-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]carbamate (PubChem CID 18108659) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18108659 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | benzyl N-[(2S)-1-(cyclohexylamino)-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H24N2O3/c1-13(16(20)19-15-10-6-3-7-11-15)18-17(21)22-12-14-8-4-2-5-9-14/h2,4-5,8-9,13,15H,3,6-7,10-12H2,1H3,(H,18,21)(H,19,20)/t13-/m0/s1 |
| InChIKey | FRXPNNABKWJRPN-ZDUSSCGKSA-N |
| XLogP | 2.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |