C19H28N2O3 — CID 51159515
benzyl N-[1-(cyclopentylamino)-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 51159515) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is benzyl N-[1-(cyclopentylamino)-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(cyclopentylamino)-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 51159515 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | benzyl N-[1-(cyclopentylamino)-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCC(C)C(NC(=O)OCc1ccccc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C19H28N2O3/c1-3-14(2)17(18(22)20-16-11-7-8-12-16)21-19(23)24-13-15-9-5-4-6-10-15/h4-6,9-10,14,16-17H,3,7-8,11-13H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | ZMFUFWBELOGFHE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |