C19H28N2O5 — CID 70116559
benzyl N-[(2S)-1-[[(3S)-2-methoxyoxolan-3-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 70116559) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(3S)-2-methoxyoxolan-3-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(3S)-2-methoxyoxolan-3-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 70116559 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | benzyl N-[(2S)-1-[[(3S)-2-methoxyoxolan-3-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@H]1CCOC1OC |
| InChI | InChI=1S/C19H28N2O5/c1-4-13(2)16(17(22)20-15-10-11-25-18(15)24-3)21-19(23)26-12-14-8-6-5-7-9-14/h5-9,13,15-16,18H,4,10-12H2,1-3H3,(H,20,22)(H,21,23)/t13?,15-,16-,18?/m0/s1 |
| InChIKey | CYSKFBXKZJGVAB-PWFYPYPJSA-N |
| XLogP | 2.21 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |