C20H32N2O5 — CID 55937546
benzyl N-[(2S,3S)-1-[3-(2-methoxyethoxy)propylamino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 55937546) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is benzyl N-[(2S,3S)-1-[3-(2-methoxyethoxy)propylamino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S)-1-[3-(2-methoxyethoxy)propylamino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 55937546 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | benzyl N-[(2S,3S)-1-[3-(2-methoxyethoxy)propylamino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC[C@H](C)[C@H](NC(=O)OCc1ccccc1)C(=O)NCCCOCCOC |
| InChI | InChI=1S/C20H32N2O5/c1-4-16(2)18(19(23)21-11-8-12-26-14-13-25-3)22-20(24)27-15-17-9-6-5-7-10-17/h5-7,9-10,16,18H,4,8,11-15H2,1-3H3,(H,21,23)(H,22,24)/t16-,18-/m0/s1 |
| InChIKey | XUYNSBVMMYVDLC-WMZOPIPTSA-N |
| XLogP | 2.50 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|