C17H26N2O4 — CID 10687296
benzyl N-[(2S)-1-(4-hydroxybutylamino)-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 10687296) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(4-hydroxybutylamino)-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(4-hydroxybutylamino)-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10687296 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | benzyl N-[(2S)-1-(4-hydroxybutylamino)-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)NCCCCO |
| InChI | InChI=1S/C17H26N2O4/c1-13(2)15(16(21)18-10-6-7-11-20)19-17(22)23-12-14-8-4-3-5-9-14/h3-5,8-9,13,15,20H,6-7,10-12H2,1-2H3,(H,18,21)(H,19,22)/t15-/m0/s1 |
| InChIKey | COMWTJHNCMUWGD-HNNXBMFYSA-N |
| XLogP | 1.83 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|