C33H48N4O6 — CID 71491088
benzyl N-[(2S)-3-methyl-1-[7-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]heptylamino]-1-oxobutan-2-yl]carbamate (PubChem CID 71491088) has the molecular formula C33H48N4O6 and a molecular weight of 596.77 g/mol. Its IUPAC name is benzyl N-[(2S)-3-methyl-1-[7-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]heptylamino]-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-3-methyl-1-[7-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]heptylamino]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 71491088 |
| Molecular Formula | C33H48N4O6 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.36 |
| IUPAC Name | benzyl N-[(2S)-3-methyl-1-[7-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]heptylamino]-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)NCCCCCCCNC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C33H48N4O6/c1-24(2)28(36-32(40)42-22-26-16-10-8-11-17-26)30(38)34-20-14-6-5-7-15-21-35-31(39)29(25(3)4)37-33(41)43-23-27-18-12-9-13-19-27/h8-13,16-19,24-25,28-29H,5-7,14-15,20-23H2,1-4H3,(H,34,38)(H,35,39)(H,36,40)(H,37,41)/t28-,29-/m0/s1 |
| InChIKey | IVNOBJNZEQBBJW-VMPREFPWSA-N |
| XLogP | 5.07 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|