C15H19N2O5- — CID 7005168
2-[[(2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetate (PubChem CID 7005168) has the molecular formula C15H19N2O5- and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-[[(2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetate.
| Compound Name | 2-[[(2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetate |
|---|---|
| PubChem CID | 7005168 |
| Molecular Formula | C15H19N2O5- |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-[[(2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetate |
| SMILES | CC(C)[C@@H](NC(=O)OCc1ccccc1)C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C15H20N2O5/c1-10(2)13(14(20)16-8-12(18)19)17-15(21)22-9-11-6-4-3-5-7-11/h3-7,10,13H,8-9H2,1-2H3,(H,16,20)(H,17,21)(H,18,19)/p-1/t13-/m1/s1 |
| InChIKey | MWOJWUBBCZRMTB-CYBMUJFWSA-M |
| XLogP | -0.20 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |