C15H20N3O4- — CID 169191617
2-[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]ethanimidate (PubChem CID 169191617) has the molecular formula C15H20N3O4- and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]ethanimidate.
| Compound Name | 2-[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]ethanimidate |
|---|---|
| PubChem CID | 169191617 |
| Molecular Formula | C15H20N3O4- |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]ethanimidate |
| SMILES | [H]/N=C(\[O-])CNC(=O)C(NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C15H21N3O4/c1-10(2)13(14(20)17-8-12(16)19)18-15(21)22-9-11-6-4-3-5-7-11/h3-7,10,13H,8-9H2,1-2H3,(H2,16,19)(H,17,20)(H,18,21)/p-1 |
| InChIKey | VDCZEFZKFQWHLK-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|