C19H25N3O4 — CID 49396049
benzyl N-[(2S,3S)-3-methyl-1-oxo-1-[[2-oxo-2-(prop-2-ynylamino)ethyl]amino]pentan-2-yl]carbamate (PubChem CID 49396049) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is benzyl N-[(2S,3S)-3-methyl-1-oxo-1-[[2-oxo-2-(prop-2-ynylamino)ethyl]amino]pentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S)-3-methyl-1-oxo-1-[[2-oxo-2-(prop-2-ynylamino)ethyl]amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 49396049 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | benzyl N-[(2S,3S)-3-methyl-1-oxo-1-[[2-oxo-2-(prop-2-ynylamino)ethyl]amino]pentan-2-yl]carbamate |
| SMILES | C#CCNC(=O)CNC(=O)[C@@H](NC(=O)OCc1ccccc1)[C@@H](C)CC |
| InChI | InChI=1S/C19H25N3O4/c1-4-11-20-16(23)12-21-18(24)17(14(3)5-2)22-19(25)26-13-15-9-7-6-8-10-15/h1,6-10,14,17H,5,11-13H2,2-3H3,(H,20,23)(H,21,24)(H,22,25)/t14-,17-/m0/s1 |
| InChIKey | XNENMMYPFBVFKC-YOEHRIQHSA-N |
| XLogP | 1.19 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|