C22H31N5O5 — CID 135479975
benzyl N-[(2S,3S)-1-[[(2S)-1-[(3-diazo-2-oxopropyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 135479975) has the molecular formula C22H31N5O5 and a molecular weight of 445.52 g/mol. Its IUPAC name is benzyl N-[(2S,3S)-1-[[(2S)-1-[(3-diazo-2-oxopropyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S)-1-[[(2S)-1-[(3-diazo-2-oxopropyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 135479975 |
| Molecular Formula | C22H31N5O5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | benzyl N-[(2S,3S)-1-[[(2S)-1-[(3-diazo-2-oxopropyl)amino]-3-methyl-1-oxobutan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC[C@H](C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@H](C(=O)NCC(=O)C=[N+]=[N-])C(C)C |
| InChI | InChI=1S/C22H31N5O5/c1-5-15(4)19(27-22(31)32-13-16-9-7-6-8-10-16)21(30)26-18(14(2)3)20(29)24-11-17(28)12-25-23/h6-10,12,14-15,18-19H,5,11,13H2,1-4H3,(H,24,29)(H,26,30)(H,27,31)/t15-,18-,19-/m0/s1 |
| InChIKey | PHVFXHHVNJWBDB-SNRMKQJTSA-N |
| XLogP | 1.45 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|