C16H23N3O4 — CID 51648070
benzyl 2-[[(2S,3R)-2-(carbamoylamino)-3-methylpentanoyl]amino]acetate (PubChem CID 51648070) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is benzyl 2-[[(2S,3R)-2-(carbamoylamino)-3-methylpentanoyl]amino]acetate.
| Compound Name | benzyl 2-[[(2S,3R)-2-(carbamoylamino)-3-methylpentanoyl]amino]acetate |
|---|---|
| PubChem CID | 51648070 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | benzyl 2-[[(2S,3R)-2-(carbamoylamino)-3-methylpentanoyl]amino]acetate |
| SMILES | CC[C@@H](C)[C@H](NC(N)=O)C(=O)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H23N3O4/c1-3-11(2)14(19-16(17)22)15(21)18-9-13(20)23-10-12-7-5-4-6-8-12/h4-8,11,14H,3,9-10H2,1-2H3,(H,18,21)(H3,17,19,22)/t11-,14+/m1/s1 |
| InChIKey | AXRTXSLLBAMENN-RISCZKNCSA-N |
| XLogP | 0.93 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |