C16H25N3O2 — CID 2562392
(2S,3R)-2-(carbamoylamino)-3-methyl-N-(3-phenylpropyl)pentanamide (PubChem CID 2562392) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is (2S,3R)-2-(carbamoylamino)-3-methyl-N-(3-phenylpropyl)pentanamide.
| Compound Name | (2S,3R)-2-(carbamoylamino)-3-methyl-N-(3-phenylpropyl)pentanamide |
|---|---|
| PubChem CID | 2562392 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | (2S,3R)-2-(carbamoylamino)-3-methyl-N-(3-phenylpropyl)pentanamide |
| SMILES | CC[C@@H](C)[C@H](NC(N)=O)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C16H25N3O2/c1-3-12(2)14(19-16(17)21)15(20)18-11-7-10-13-8-5-4-6-9-13/h4-6,8-9,12,14H,3,7,10-11H2,1-2H3,(H,18,20)(H3,17,19,21)/t12-,14+/m1/s1 |
| InChIKey | KDWVHZQBKSPSCZ-OCCSQVGLSA-N |
| XLogP | 1.82 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|