C13H19N3O2 — CID 94187133
(2R)-2-(carbamoylamino)-N-(3-phenylpropyl)propanamide (PubChem CID 94187133) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is (2R)-2-(carbamoylamino)-N-(3-phenylpropyl)propanamide.
| Compound Name | (2R)-2-(carbamoylamino)-N-(3-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 94187133 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (2R)-2-(carbamoylamino)-N-(3-phenylpropyl)propanamide |
| SMILES | C[C@@H](NC(N)=O)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C13H19N3O2/c1-10(16-13(14)18)12(17)15-9-5-8-11-6-3-2-4-7-11/h2-4,6-7,10H,5,8-9H2,1H3,(H,15,17)(H3,14,16,18)/t10-/m1/s1 |
| InChIKey | WQRVBJPFIGYZQX-SNVBAGLBSA-N |
| XLogP | 0.79 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|