C10H15ClN2O — CID 174579396
3-phenylpropylurea;hydrochloride (PubChem CID 174579396) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is 3-phenylpropylurea;hydrochloride.
| Compound Name | 3-phenylpropylurea;hydrochloride |
|---|---|
| PubChem CID | 174579396 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 3-phenylpropylurea;hydrochloride |
| SMILES | Cl.NC(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C10H14N2O.ClH/c11-10(13)12-8-4-7-9-5-2-1-3-6-9;/h1-3,5-6H,4,7-8H2,(H3,11,12,13);1H |
| InChIKey | XEAAYSGOZPWKOH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|