C11H18ClN3 — CID 175076305
2-methyl-1-(3-phenylpropyl)guanidine;hydrochloride (PubChem CID 175076305) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 2-methyl-1-(3-phenylpropyl)guanidine;hydrochloride.
| Compound Name | 2-methyl-1-(3-phenylpropyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 175076305 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-methyl-1-(3-phenylpropyl)guanidine;hydrochloride |
| SMILES | C/N=C(\N)NCCCc1ccccc1.Cl |
| InChI | InChI=1S/C11H17N3.ClH/c1-13-11(12)14-9-5-8-10-6-3-2-4-7-10;/h2-4,6-7H,5,8-9H2,1H3,(H3,12,13,14);1H |
| InChIKey | KNKFTHWCEGNPIZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|