C15H25N3O2S — CID 111198598
1-(2-ethylsulfonylethyl)-2-methyl-3-(3-phenylpropyl)guanidine (PubChem CID 111198598) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 1-(2-ethylsulfonylethyl)-2-methyl-3-(3-phenylpropyl)guanidine.
| Compound Name | 1-(2-ethylsulfonylethyl)-2-methyl-3-(3-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 111198598 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-(2-ethylsulfonylethyl)-2-methyl-3-(3-phenylpropyl)guanidine |
| SMILES | CCS(=O)(=O)CCN/C(=N\C)NCCCc1ccccc1 |
| InChI | InChI=1S/C15H25N3O2S/c1-3-21(19,20)13-12-18-15(16-2)17-11-7-10-14-8-5-4-6-9-14/h4-6,8-9H,3,7,10-13H2,1-2H3,(H2,16,17,18) |
| InChIKey | BXKYQOPLHPTZOY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|