C18H24N4O2S — CID 111199024
2-methyl-1-(3-phenylpropyl)-3-[(3-sulfamoylphenyl)methyl]guanidine (PubChem CID 111199024) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-methyl-1-(3-phenylpropyl)-3-[(3-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-(3-phenylpropyl)-3-[(3-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111199024 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-methyl-1-(3-phenylpropyl)-3-[(3-sulfamoylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCCCc1ccccc1)NCc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C18H24N4O2S/c1-20-18(21-12-6-10-15-7-3-2-4-8-15)22-14-16-9-5-11-17(13-16)25(19,23)24/h2-5,7-9,11,13H,6,10,12,14H2,1H3,(H2,19,23,24)(H2,20,21,22) |
| InChIKey | CPNLXZZGJWRICG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|