C17H23IN4O3S — CID 111249882
1-[(3-methoxyphenyl)methyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111249882) has the molecular formula C17H23IN4O3S and a molecular weight of 490.37 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111249882 |
| Molecular Formula | C17H23IN4O3S |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(OC)c1)NCc1cccc(S(N)(=O)=O)c1.I |
| InChI | InChI=1S/C17H22N4O3S.HI/c1-19-17(20-11-13-5-3-7-15(9-13)24-2)21-12-14-6-4-8-16(10-14)25(18,22)23;/h3-10H,11-12H2,1-2H3,(H2,18,22,23)(H2,19,20,21);1H |
| InChIKey | SPOOITFOTZMTAI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|