C18H24IN3O3S — CID 111249126
1-[2-(benzenesulfonyl)ethyl]-3-[(3-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111249126) has the molecular formula C18H24IN3O3S and a molecular weight of 489.38 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-3-[(3-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-3-[(3-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111249126 |
| Molecular Formula | C18H24IN3O3S |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-3-[(3-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)c1ccccc1)NCc1cccc(OC)c1.I |
| InChI | InChI=1S/C18H23N3O3S.HI/c1-19-18(21-14-15-7-6-8-16(13-15)24-2)20-11-12-25(22,23)17-9-4-3-5-10-17;/h3-10,13H,11-12,14H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | QYQWGSDSESTYNH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|