C18H24N4O4S — CID 111878181
1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine (PubChem CID 111878181) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111878181 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-2-methyl-3-[(3-sulfamoylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cccc(S(N)(=O)=O)c1)NCc1ccc(OC)cc1OC |
| InChI | InChI=1S/C18H24N4O4S/c1-20-18(21-11-13-5-4-6-16(9-13)27(19,23)24)22-12-14-7-8-15(25-2)10-17(14)26-3/h4-10H,11-12H2,1-3H3,(H2,19,23,24)(H2,20,21,22) |
| InChIKey | GWHKRKYJLHXQAM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|