C20H29IN4O3S — CID 111690885
2-methyl-1-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111690885) has the molecular formula C20H29IN4O3S and a molecular weight of 532.45 g/mol. Its IUPAC name is 2-methyl-1-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111690885 |
| Molecular Formula | C20H29IN4O3S |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | 2-methyl-1-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]-3-[(3-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(S(N)(=O)=O)c1)NCc1ccccc1OC(C)(C)C.I |
| InChI | InChI=1S/C20H28N4O3S.HI/c1-20(2,3)27-18-11-6-5-9-16(18)14-24-19(22-4)23-13-15-8-7-10-17(12-15)28(21,25)26;/h5-12H,13-14H2,1-4H3,(H2,21,25,26)(H2,22,23,24);1H |
| InChIKey | ZXTWZNVEZABHEZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|