C24H35IN4O2 — CID 111690367
N-[3-[[[N'-methyl-N-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide (PubChem CID 111690367) has the molecular formula C24H35IN4O2 and a molecular weight of 538.47 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide.
| Compound Name | N-[3-[[[N'-methyl-N-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111690367 |
| Molecular Formula | C24H35IN4O2 |
| Molecular Weight | 538.47 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | N-[3-[[[N'-methyl-N-[[2-[(2-methylpropan-2-yl)oxy]phenyl]methyl]carbamimidoyl]amino]methyl]phenyl]butanamide;hydroiodide |
| SMILES | CCCC(=O)Nc1cccc(CN/C(=N/C)NCc2ccccc2OC(C)(C)C)c1.I |
| InChI | InChI=1S/C24H34N4O2.HI/c1-6-10-22(29)28-20-13-9-11-18(15-20)16-26-23(25-5)27-17-19-12-7-8-14-21(19)30-24(2,3)4;/h7-9,11-15H,6,10,16-17H2,1-5H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | AQQKOCMXJQHYHJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|