C21H24F4N4O — CID 111889421
N-[3-[[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]butanamide (PubChem CID 111889421) has the molecular formula C21H24F4N4O and a molecular weight of 424.44 g/mol. Its IUPAC name is N-[3-[[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]butanamide.
| Compound Name | N-[3-[[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 111889421 |
| Molecular Formula | C21H24F4N4O |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-[3-[[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(CN/C(=N\C)NCc2ccc(F)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C21H24F4N4O/c1-3-5-19(30)29-17-7-4-6-14(10-17)12-27-20(26-2)28-13-15-8-9-16(22)11-18(15)21(23,24)25/h4,6-11H,3,5,12-13H2,1-2H3,(H,29,30)(H2,26,27,28) |
| InChIKey | AUVJNIXDYBQYCN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|