C22H20F4N4O2 — CID 111889513
N-[3-[[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 111889513) has the molecular formula C22H20F4N4O2 and a molecular weight of 448.42 g/mol. Its IUPAC name is N-[3-[[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111889513 |
| Molecular Formula | C22H20F4N4O2 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-[3-[[[N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | C/N=C(\NCc1cccc(NC(=O)c2ccco2)c1)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C22H20F4N4O2/c1-27-21(29-13-15-7-8-16(23)11-18(15)22(24,25)26)28-12-14-4-2-5-17(10-14)30-20(31)19-6-3-9-32-19/h2-11H,12-13H2,1H3,(H,30,31)(H2,27,28,29) |
| InChIKey | MBSWSGJTQPPIDQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|