C19H26N4O2 — CID 111128629
N-[3-[[(N'-methyl-N-pentylcarbamimidoyl)amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 111128629) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[3-[[(N'-methyl-N-pentylcarbamimidoyl)amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[(N'-methyl-N-pentylcarbamimidoyl)amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111128629 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[3-[[(N'-methyl-N-pentylcarbamimidoyl)amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | CCCCCN/C(=N\C)NCc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C19H26N4O2/c1-3-4-5-11-21-19(20-2)22-14-15-8-6-9-16(13-15)23-18(24)17-10-7-12-25-17/h6-10,12-13H,3-5,11,14H2,1-2H3,(H,23,24)(H2,20,21,22) |
| InChIKey | HMXRFKBGPDBBMR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|