C23H30IN5O3 — CID 111674553
N-[3-[[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111674553) has the molecular formula C23H30IN5O3 and a molecular weight of 551.43 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111674553 |
| Molecular Formula | C23H30IN5O3 |
| Molecular Weight | 551.43 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | N-[3-[[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCC(CC)c1cc(CN/C(=N\C)NCc2cccc(NC(=O)c3ccco3)c2)on1.I |
| InChI | InChI=1S/C23H29N5O3.HI/c1-4-17(5-2)20-13-19(31-28-20)15-26-23(24-3)25-14-16-8-6-9-18(12-16)27-22(29)21-10-7-11-30-21;/h6-13,17H,4-5,14-15H2,1-3H3,(H,27,29)(H2,24,25,26);1H |
| InChIKey | DWOQOICMVBKPKJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|