C20H30IN5O3 — CID 111675753
methyl N-[4-[[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]phenyl]carbamate;hydroiodide (PubChem CID 111675753) has the molecular formula C20H30IN5O3 and a molecular weight of 515.40 g/mol. Its IUPAC name is methyl N-[4-[[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]phenyl]carbamate;hydroiodide.
| Compound Name | methyl N-[4-[[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]phenyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111675753 |
| Molecular Formula | C20H30IN5O3 |
| Molecular Weight | 515.40 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | methyl N-[4-[[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]phenyl]carbamate;hydroiodide |
| SMILES | CCC(CC)c1cc(CN/C(=N\C)NCc2ccc(NC(=O)OC)cc2)on1.I |
| InChI | InChI=1S/C20H29N5O3.HI/c1-5-15(6-2)18-11-17(28-25-18)13-23-19(21-3)22-12-14-7-9-16(10-8-14)24-20(26)27-4;/h7-11,15H,5-6,12-13H2,1-4H3,(H,24,26)(H2,21,22,23);1H |
| InChIKey | LUYVMIRALHZMRQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|