C17H32IN5O2 — CID 111675459
2-methyl-N-[2-[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide (PubChem CID 111675459) has the molecular formula C17H32IN5O2 and a molecular weight of 465.38 g/mol. Its IUPAC name is 2-methyl-N-[2-[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide.
| Compound Name | 2-methyl-N-[2-[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111675459 |
| Molecular Formula | C17H32IN5O2 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2-methyl-N-[2-[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide |
| SMILES | CCC(CC)c1cc(CN/C(=N/C)NCCNC(=O)C(C)C)on1.I |
| InChI | InChI=1S/C17H31N5O2.HI/c1-6-13(7-2)15-10-14(24-22-15)11-21-17(18-5)20-9-8-19-16(23)12(3)4;/h10,12-13H,6-9,11H2,1-5H3,(H,19,23)(H2,18,20,21);1H |
| InChIKey | XUEYJHZQZRLTBQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|