C18H33N5O2 — CID 111676454
2,2-dimethyl-N-[2-[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]propanamide (PubChem CID 111676454) has the molecular formula C18H33N5O2 and a molecular weight of 351.50 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 111676454 |
| Molecular Formula | C18H33N5O2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | 2,2-dimethyl-N-[2-[[N'-methyl-N-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]ethyl]propanamide |
| SMILES | CCC(CC)c1cc(CN/C(=N/C)NCCNC(=O)C(C)(C)C)on1 |
| InChI | InChI=1S/C18H33N5O2/c1-7-13(8-2)15-11-14(25-23-15)12-22-17(19-6)21-10-9-20-16(24)18(3,4)5/h11,13H,7-10,12H2,1-6H3,(H,20,24)(H2,19,21,22) |
| InChIKey | XYAAPFAEJDWIKY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|