C14H26N4O3S — CID 111675400
2-methyl-1-(2-methylsulfonylethyl)-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111675400) has the molecular formula C14H26N4O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is 2-methyl-1-(2-methylsulfonylethyl)-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-(2-methylsulfonylethyl)-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111675400 |
| Molecular Formula | C14H26N4O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-methyl-1-(2-methylsulfonylethyl)-3-[(3-pentan-3-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | CCC(CC)c1cc(CN/C(=N/C)NCCS(C)(=O)=O)on1 |
| InChI | InChI=1S/C14H26N4O3S/c1-5-11(6-2)13-9-12(21-18-13)10-17-14(15-3)16-7-8-22(4,19)20/h9,11H,5-8,10H2,1-4H3,(H2,15,16,17) |
| InChIKey | JZEJQUONFGRBTE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|