C22H33IN4O4 — CID 111692939
N-[4-[[[N-[2-(2-butoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111692939) has the molecular formula C22H33IN4O4 and a molecular weight of 544.43 g/mol. Its IUPAC name is N-[4-[[[N-[2-(2-butoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[4-[[[N-[2-(2-butoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111692939 |
| Molecular Formula | C22H33IN4O4 |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | N-[4-[[[N-[2-(2-butoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCCCOCCOCCN/C(=N\C)NCc1ccc(NC(=O)c2ccco2)cc1.I |
| InChI | InChI=1S/C22H32N4O4.HI/c1-3-4-12-28-15-16-29-14-11-24-22(23-2)25-17-18-7-9-19(10-8-18)26-21(27)20-6-5-13-30-20;/h5-10,13H,3-4,11-12,14-17H2,1-2H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | AEMORAPSQCYDSW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|