C22H25IN4O3 — CID 111215746
N-[4-[[[N-[(2-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111215746) has the molecular formula C22H25IN4O3 and a molecular weight of 520.37 g/mol. Its IUPAC name is N-[4-[[[N-[(2-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[4-[[[N-[(2-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111215746 |
| Molecular Formula | C22H25IN4O3 |
| Molecular Weight | 520.37 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | N-[4-[[[N-[(2-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(NC(=O)c2ccco2)cc1)NCc1ccccc1OC.I |
| InChI | InChI=1S/C22H24N4O3.HI/c1-23-22(25-15-17-6-3-4-7-19(17)28-2)24-14-16-9-11-18(12-10-16)26-21(27)20-8-5-13-29-20;/h3-13H,14-15H2,1-2H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | RADLKVQUUIDUHQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|