C25H29N5O3 — CID 111133677
N-[4-[[[C-[4-(2-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 111133677) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-[4-[[[C-[4-(2-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[[C-[4-(2-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111133677 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | N-[4-[[[C-[4-(2-methoxyphenyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | C/N=C(\NCc1ccc(NC(=O)c2ccco2)cc1)N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C25H29N5O3/c1-26-25(30-15-13-29(14-16-30)21-6-3-4-7-22(21)32-2)27-18-19-9-11-20(12-10-19)28-24(31)23-8-5-17-33-23/h3-12,17H,13-16,18H2,1-2H3,(H,26,27)(H,28,31) |
| InChIKey | FAVXRPQYAWVOTQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|