C26H30N4O4 — CID 42755875
N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(propylcarbamoyl)phenyl]furan-2-carboxamide (PubChem CID 42755875) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(propylcarbamoyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(propylcarbamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42755875 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(propylcarbamoyl)phenyl]furan-2-carboxamide |
| SMILES | CCCNC(=O)c1cc(NC(=O)c2ccco2)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C26H30N4O4/c1-3-12-27-25(31)20-18-19(28-26(32)24-9-6-17-34-24)10-11-21(20)29-13-15-30(16-14-29)22-7-4-5-8-23(22)33-2/h4-11,17-18H,3,12-16H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | VIWJGPJRJAOUHC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|