C29H35N5O3S — CID 42660869
2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(4-methylsulfanylphenyl)carbamoylamino]-N-propylbenzamide (PubChem CID 42660869) has the molecular formula C29H35N5O3S and a molecular weight of 533.70 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(4-methylsulfanylphenyl)carbamoylamino]-N-propylbenzamide.
| Compound Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(4-methylsulfanylphenyl)carbamoylamino]-N-propylbenzamide |
|---|---|
| PubChem CID | 42660869 |
| Molecular Formula | C29H35N5O3S |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)piperazin-1-yl]-5-[(4-methylsulfanylphenyl)carbamoylamino]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1cc(NC(=O)Nc2ccc(SC)cc2)ccc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C29H35N5O3S/c1-4-15-30-28(35)24-20-22(32-29(36)31-21-9-12-23(38-3)13-10-21)11-14-25(24)33-16-18-34(19-17-33)26-7-5-6-8-27(26)37-2/h5-14,20H,4,15-19H2,1-3H3,(H,30,35)(H2,31,32,36) |
| InChIKey | BYZSAUFZUFIPJG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|