C31H37N5O3S — CID 42660031
1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]-3-(4-methylsulfanylphenyl)urea (PubChem CID 42660031) has the molecular formula C31H37N5O3S and a molecular weight of 559.74 g/mol. Its IUPAC name is 1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]-3-(4-methylsulfanylphenyl)urea.
| Compound Name | 1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]-3-(4-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 42660031 |
| Molecular Formula | C31H37N5O3S |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | 1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(piperidine-1-carbonyl)phenyl]-3-(4-methylsulfanylphenyl)urea |
| SMILES | COc1ccccc1N1CCN(c2ccc(NC(=O)Nc3ccc(SC)cc3)cc2C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C31H37N5O3S/c1-39-29-9-5-4-8-28(29)35-20-18-34(19-21-35)27-15-12-24(22-26(27)30(37)36-16-6-3-7-17-36)33-31(38)32-23-10-13-25(40-2)14-11-23/h4-5,8-15,22H,3,6-7,16-21H2,1-2H3,(H2,32,33,38) |
| InChIKey | ZOIVYVGECFEPRG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|