C26H34N4O2 — CID 1065193
1-[4-piperidin-1-yl-3-(pyrrolidine-1-carbonyl)phenyl]-3-(4-propan-2-ylphenyl)urea (PubChem CID 1065193) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 1-[4-piperidin-1-yl-3-(pyrrolidine-1-carbonyl)phenyl]-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-[4-piperidin-1-yl-3-(pyrrolidine-1-carbonyl)phenyl]-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 1065193 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 1-[4-piperidin-1-yl-3-(pyrrolidine-1-carbonyl)phenyl]-3-(4-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccc(NC(=O)Nc2ccc(N3CCCCC3)c(C(=O)N3CCCC3)c2)cc1 |
| InChI | InChI=1S/C26H34N4O2/c1-19(2)20-8-10-21(11-9-20)27-26(32)28-22-12-13-24(29-14-4-3-5-15-29)23(18-22)25(31)30-16-6-7-17-30/h8-13,18-19H,3-7,14-17H2,1-2H3,(H2,27,28,32) |
| InChIKey | HXDXFOAZYVOONL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|