C21H32N4O2 — CID 42751582
1-butyl-3-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]urea (PubChem CID 42751582) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-butyl-3-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]urea.
| Compound Name | 1-butyl-3-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]urea |
|---|---|
| PubChem CID | 42751582 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 1-butyl-3-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]urea |
| SMILES | CCCCNC(=O)Nc1ccc(N2CCCC2)c(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C21H32N4O2/c1-2-3-11-22-21(27)23-17-9-10-19(24-12-7-8-13-24)18(16-17)20(26)25-14-5-4-6-15-25/h9-10,16H,2-8,11-15H2,1H3,(H2,22,23,27) |
| InChIKey | HTAGHRPXHSCUDH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|