C20H27N3O2 — CID 42751185
N-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]cyclopropanecarboxamide (PubChem CID 42751185) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is N-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 42751185 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-[3-(piperidine-1-carbonyl)-4-pyrrolidin-1-ylphenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(C(=O)N2CCCCC2)c1)C1CC1 |
| InChI | InChI=1S/C20H27N3O2/c24-19(15-6-7-15)21-16-8-9-18(22-10-4-5-11-22)17(14-16)20(25)23-12-2-1-3-13-23/h8-9,14-15H,1-7,10-13H2,(H,21,24) |
| InChIKey | QXPGXWYESNOFOT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|