C28H34ClN5O3 — CID 42672554
N-(3-chlorophenyl)-4-[4-(cyclopentanecarbonylamino)-2-(pyrrolidine-1-carbonyl)phenyl]piperazine-1-carboxamide (PubChem CID 42672554) has the molecular formula C28H34ClN5O3 and a molecular weight of 524.07 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[4-(cyclopentanecarbonylamino)-2-(pyrrolidine-1-carbonyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4-[4-(cyclopentanecarbonylamino)-2-(pyrrolidine-1-carbonyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42672554 |
| Molecular Formula | C28H34ClN5O3 |
| Molecular Weight | 524.07 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | N-(3-chlorophenyl)-4-[4-(cyclopentanecarbonylamino)-2-(pyrrolidine-1-carbonyl)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)Nc3cccc(Cl)c3)CC2)c(C(=O)N2CCCC2)c1)C1CCCC1 |
| InChI | InChI=1S/C28H34ClN5O3/c29-21-8-5-9-22(18-21)31-28(37)34-16-14-32(15-17-34)25-11-10-23(30-26(35)20-6-1-2-7-20)19-24(25)27(36)33-12-3-4-13-33/h5,8-11,18-20H,1-4,6-7,12-17H2,(H,30,35)(H,31,37) |
| InChIKey | ZSJYWXRECLBCDL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.07 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|