C28H34FN5O3 — CID 42672082
4-[4-(cyclopentanecarbonylamino)-2-(pyrrolidine-1-carbonyl)phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide (PubChem CID 42672082) has the molecular formula C28H34FN5O3 and a molecular weight of 507.61 g/mol. Its IUPAC name is 4-[4-(cyclopentanecarbonylamino)-2-(pyrrolidine-1-carbonyl)phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-(cyclopentanecarbonylamino)-2-(pyrrolidine-1-carbonyl)phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42672082 |
| Molecular Formula | C28H34FN5O3 |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 4-[4-(cyclopentanecarbonylamino)-2-(pyrrolidine-1-carbonyl)phenyl]-N-(2-fluorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)Nc3ccccc3F)CC2)c(C(=O)N2CCCC2)c1)C1CCCC1 |
| InChI | InChI=1S/C28H34FN5O3/c29-23-9-3-4-10-24(23)31-28(37)34-17-15-32(16-18-34)25-12-11-21(30-26(35)20-7-1-2-8-20)19-22(25)27(36)33-13-5-6-14-33/h3-4,9-12,19-20H,1-2,5-8,13-18H2,(H,30,35)(H,31,37) |
| InChIKey | KRJQJZQXEUIMMC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|