C29H32FN5O3S — CID 42678976
N-(2-fluorophenyl)-4-[2-(piperidine-1-carbonyl)-4-(thiophene-2-carbonylamino)phenyl]-1,4-diazepane-1-carboxamide (PubChem CID 42678976) has the molecular formula C29H32FN5O3S and a molecular weight of 549.67 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-[2-(piperidine-1-carbonyl)-4-(thiophene-2-carbonylamino)phenyl]-1,4-diazepane-1-carboxamide.
| Compound Name | N-(2-fluorophenyl)-4-[2-(piperidine-1-carbonyl)-4-(thiophene-2-carbonylamino)phenyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 42678976 |
| Molecular Formula | C29H32FN5O3S |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | N-(2-fluorophenyl)-4-[2-(piperidine-1-carbonyl)-4-(thiophene-2-carbonylamino)phenyl]-1,4-diazepane-1-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCN(C(=O)Nc3ccccc3F)CC2)c(C(=O)N2CCCCC2)c1)c1cccs1 |
| InChI | InChI=1S/C29H32FN5O3S/c30-23-8-2-3-9-24(23)32-29(38)35-16-7-15-33(17-18-35)25-12-11-21(31-27(36)26-10-6-19-39-26)20-22(25)28(37)34-13-4-1-5-14-34/h2-3,6,8-12,19-20H,1,4-5,7,13-18H2,(H,31,36)(H,32,38) |
| InChIKey | UEBLHYZWCRUIAA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|