C29H34FN5O3S — CID 42678677
N-tert-butyl-4-[2-[(4-fluorophenyl)methylcarbamoyl]-4-(thiophene-2-carbonylamino)phenyl]-1,4-diazepane-1-carboxamide (PubChem CID 42678677) has the molecular formula C29H34FN5O3S and a molecular weight of 551.69 g/mol. Its IUPAC name is N-tert-butyl-4-[2-[(4-fluorophenyl)methylcarbamoyl]-4-(thiophene-2-carbonylamino)phenyl]-1,4-diazepane-1-carboxamide.
| Compound Name | N-tert-butyl-4-[2-[(4-fluorophenyl)methylcarbamoyl]-4-(thiophene-2-carbonylamino)phenyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 42678677 |
| Molecular Formula | C29H34FN5O3S |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | N-tert-butyl-4-[2-[(4-fluorophenyl)methylcarbamoyl]-4-(thiophene-2-carbonylamino)phenyl]-1,4-diazepane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCCN(c2ccc(NC(=O)c3cccs3)cc2C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H34FN5O3S/c1-29(2,3)33-28(38)35-14-5-13-34(15-16-35)24-12-11-22(32-27(37)25-6-4-17-39-25)18-23(24)26(36)31-19-20-7-9-21(30)10-8-20/h4,6-12,17-18H,5,13-16,19H2,1-3H3,(H,31,36)(H,32,37)(H,33,38) |
| InChIKey | BFPVDTFVCUSTQF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|