C29H38FN5O3 — CID 42678676
N-tert-butyl-4-[4-(cyclobutanecarbonylamino)-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-1,4-diazepane-1-carboxamide (PubChem CID 42678676) has the molecular formula C29H38FN5O3 and a molecular weight of 523.65 g/mol. Its IUPAC name is N-tert-butyl-4-[4-(cyclobutanecarbonylamino)-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-1,4-diazepane-1-carboxamide.
| Compound Name | N-tert-butyl-4-[4-(cyclobutanecarbonylamino)-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 42678676 |
| Molecular Formula | C29H38FN5O3 |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.30 |
| IUPAC Name | N-tert-butyl-4-[4-(cyclobutanecarbonylamino)-2-[(4-fluorophenyl)methylcarbamoyl]phenyl]-1,4-diazepane-1-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCCN(c2ccc(NC(=O)C3CCC3)cc2C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H38FN5O3/c1-29(2,3)33-28(38)35-15-5-14-34(16-17-35)25-13-12-23(32-26(36)21-6-4-7-21)18-24(25)27(37)31-19-20-8-10-22(30)11-9-20/h8-13,18,21H,4-7,14-17,19H2,1-3H3,(H,31,37)(H,32,36)(H,33,38) |
| InChIKey | CSGYCLQAZPLFSZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|